| Compound Information | SONAR Target prediction | | Name: | 6,4--DIHYDROXYFLAVONE | | Unique Identifier: | SPE01500717 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O4 | | Molecular Weight: | 244.158 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | Oc1ccc(cc1)C1Oc2ccc(O)cc2C(=O)C=1 | | Class: | flavone | | Source: | Cassia spp as glycoside | | Therapeutics: | antihaemorrhagic |
| Species: |
4932 |
| Condition: |
WHI5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6360±0.0704985 |
| Normalized OD Score: sc h |
0.9178±0.094063 |
| Z-Score: |
-3.0073±3.6959 |
| p-Value: |
0.346822 |
| Z-Factor: |
-3.18926 |
| Fitness Defect: |
1.0589 |
| Bioactivity Statement: |
Outlier |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.10 Celcius | | Date: | 2008-09-16 YYYY-MM-DD | | Plate CH Control (+): | 0.041874999999999996±0.00098 | | Plate DMSO Control (-): | 0.685125±0.01193 | | Plate Z-Factor: | 0.9521 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
|
