Compound Information | SONAR Target prediction | Name: | CHRYSIN | Unique Identifier: | SPE01500709 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 16.715 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 | Class: | flavone | Source: | Pinus, Scutellaria, and Ulnus spp | Therapeutics: | diuretic |
Species: |
4932 |
Condition: |
SER1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4287±0.0399515 |
Normalized OD Score: sc h |
0.7606±0.038428 |
Z-Score: |
-7.5274±1.00386 |
p-Value: |
0.0000000000046294 |
Z-Factor: |
-3.17098 |
Fitness Defect: |
26.0986 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 19|F3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.30 Celcius | Date: | 2007-09-17 YYYY-MM-DD | Plate CH Control (+): | 0.039775000000000005±0.00030 | Plate DMSO Control (-): | 0.553725±0.11026 | Plate Z-Factor: | 0.2873 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 27 | 1 2 3 4 5 Next >> |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 | |
|