| 
 | Compound Information | SONAR Target prediction |  | Name: | CHRYSIN |  | Unique Identifier: | SPE01500709 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 16.715  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 |  | Class: | flavone |  | Source: | Pinus, Scutellaria, and Ulnus spp |  | Therapeutics: | diuretic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741-2nd |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6734±0.0127279 |  
		| Normalized OD Score: sc h | 0.9590±0.0154068 |  
		| Z-Score: | -1.2647±0.564749 |  
		| p-Value: | 0.241472 |  
		| Z-Factor: | -2.44334 |  
		| Fitness Defect: | 1.421 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 21|G11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.80 Celcius |  | Date: | 2008-02-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0404±0.00086 |  | Plate DMSO Control (-): | 0.6778499999999998±0.01923 |  | Plate Z-Factor: | 0.9146 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 5281607 | 5,7-dihydroxy-2-phenyl-chromen-4-one |  
 | internal high similarity DBLink  | Rows returned: 27 | 1 2 3 4 5 Next >> | 
 
 | active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 |  | 
 
 |