| Compound Information | SONAR Target prediction | | Name: | CHRYSIN | | Unique Identifier: | SPE01500709 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 16.715 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 | | Class: | flavone | | Source: | Pinus, Scutellaria, and Ulnus spp | | Therapeutics: | diuretic |
| Species: |
4932 |
| Condition: |
SAC3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4094±0.0181726 |
| Normalized OD Score: sc h |
0.8531±0.017701 |
| Z-Score: |
-4.2428±0.405645 |
| p-Value: |
0.0000410716 |
| Z-Factor: |
-0.276088 |
| Fitness Defect: |
10.1002 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 21|G11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2008-05-16 YYYY-MM-DD | | Plate CH Control (+): | 0.0406±0.00105 | | Plate DMSO Control (-): | 0.45685±0.02074 | | Plate Z-Factor: | 0.8248 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 27 | << Back 1 2 3 4 5 |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 | |
|
