Compound Information | SONAR Target prediction | Name: | CHRYSIN | Unique Identifier: | SPE01500709 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 16.715 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 | Class: | flavone | Source: | Pinus, Scutellaria, and Ulnus spp | Therapeutics: | diuretic |
Species: |
4932 |
Condition: |
SPE01504082 |
Replicates: |
2 |
Raw OD Value: r im |
0.6778±0.0352846 |
Normalized OD Score: sc h |
0.8559±0.022762 |
Z-Score: |
-5.5697±0.108102 |
p-Value: |
0.0000000279324 |
Z-Factor: |
-1.47933 |
Fitness Defect: |
17.3935 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|B4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.20 Celcius | Date: | 2006-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.040225±0.00212 | Plate DMSO Control (-): | 0.82945±0.20702 | Plate Z-Factor: | 0.3332 |
| png ps pdf |
DBLink | Rows returned: 1 | |
5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
internal high similarity DBLink | Rows returned: 27 | << Back 1 2 3 4 5 |
active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 | |
|