| Compound Information | SONAR Target prediction | | Name: | CHRYSIN | | Unique Identifier: | SPE01500709 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 16.715 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 | | Class: | flavone | | Source: | Pinus, Scutellaria, and Ulnus spp | | Therapeutics: | diuretic |
| Species: |
4932 |
| Condition: |
SER1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4287±0.0399515 |
| Normalized OD Score: sc h |
0.7606±0.038428 |
| Z-Score: |
-7.5274±1.00386 |
| p-Value: |
0.0000000000046294 |
| Z-Factor: |
-3.17098 |
| Fitness Defect: |
26.0986 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 19|F3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.30 Celcius | | Date: | 2007-09-17 YYYY-MM-DD | | Plate CH Control (+): | 0.039775000000000005±0.00030 | | Plate DMSO Control (-): | 0.553725±0.11026 | | Plate Z-Factor: | 0.2873 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 | |
|
