| Compound Information | SONAR Target prediction | | Name: | CHRYSIN | | Unique Identifier: | SPE01500709 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 16.715 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1cc(O)c2C(=O)C=C(Oc2c1)c1ccccc1 | | Class: | flavone | | Source: | Pinus, Scutellaria, and Ulnus spp | | Therapeutics: | diuretic |
| Species: |
4932 |
| Condition: |
SPE00300348 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2571±0.00827315 |
| Normalized OD Score: sc h |
4.0764±0.0809268 |
| Z-Score: |
43.4792±2.6084 |
| p-Value: |
0 |
| Z-Factor: |
-71.1361 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|B4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.00 Celcius | | Date: | 2006-12-21 YYYY-MM-DD | | Plate CH Control (+): | 0.041175±0.00184 | | Plate DMSO Control (-): | 0.0684±0.28623 | | Plate Z-Factor: | -2.4802 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5281607 |
5,7-dihydroxy-2-phenyl-chromen-4-one |
| active | Cluster 1884 | Additional Members: 20 | Rows returned: 5 | |
|
