Compound Information | SONAR Target prediction | Name: | QUERCETIN | Unique Identifier: | SPE01500672 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 292.156 g/mol | X log p: | 11.519 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1cc(O)c2C(=O)C(O)=C(Oc2c1)c1ccc(O)c(O)c1 | Class: | flavone | Source: | Solanaceae, Rhamnaceae, Passifloraceae, Umbelliferae genera | Reference: | Chem Ber 103:3674 (1970); Experientia 28:380 (1972); Phytochemistry 12:1787 (1973); IARC Monog 31:213 Suppl 7:71 (1983); Antiviral Res 12:99 (1989) | Therapeutics: | capillary protectant, antioxidant. antineoplastic, anti-HIV; LD50(mouse) 159 mg/kg po | Generic_name: | 2-(3,4,5-TRIHYDROXYPHENYL)-3,5,7-TRIHYDR | Chemical_iupac_name: | 3,5,7-TRIHYDROXY-2-(3,4,5-TRIHYDROXYPHENYL)-4H-CHROMEN-4-ONE | Drug_type: | Experimental | Drugbank_id: | EXPT02265 | Drug_category: | Phosphatidylinositol 3-Kinase Catalytic Subu inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SPE01500521 |
Replicates: |
2 |
Raw OD Value: r im |
0.5428±0.0148492 |
Normalized OD Score: sc h |
7.6233±0.192567 |
Z-Score: |
90.5860±1.8481 |
p-Value: |
0 |
Z-Factor: |
-2.29175 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|B3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2007-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.048549999999999996±0.00139 | Plate DMSO Control (-): | 0.07655±0.29189 | Plate Z-Factor: | -2.4474 |
| png ps pdf |
DBLink | Rows returned: 3 | |
5280343 |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one |
5281672 |
3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
5284452 |
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-chromen-4-one dihydrate |
internal high similarity DBLink | Rows returned: 12 | 1 2 Next >> |
active | Cluster 10732 | Additional Members: 22 | Rows returned: 7 | 1 2 Next >> |
|