| Compound Information | SONAR Target prediction | | Name: | ADENOSINE PHOSPHATE | | Unique Identifier: | SPE01500667 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 333.11 g/mol | | X log p: | 1.065 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 85.66 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 12 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | Nc1ncnc2n(cnc12)C1OC(COP(O)(O)=O)C(O)C1O | | Class: | alkaloid | | Source: | widespread in living tissue | | Therapeutics: | vasodilator, neuromodulator | | Generic_name: | Adenosine-5--Monophosphate | | Chemical_iupac_name: | [5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid | | Drug_type: | Experimental | | Kegg_compound_id: | C00020 | | Drugbank_id: | EXPT00362 | | Melting_point: | 183-188 oC | | H2o_solubility: | Soluble | | Logp: | -1.6 | | Cas_registry_number: | 61-19-8 | | Drug_category: | Dietary supplement; Micronutrient | | Indication: | For nutritional supplementation, also for treating dietary shortage or imbalance | | Pharmacology: | Adenosine monophosphate, also known as 5--adenylic acid and abbreviated AMP, is a nucleotide that is found in RNA. It is an ester of phosphoric acid with the nucleoside adenosine. AMP consists of the phosphate group, the pentose sugar ribose, and the nucleobase adenine. AMP is used as a dietary supplement to boost immune activity, and is also used as a substitute sweetener to aid in the maintenance of a low-calorie diet. | | Mechanism_of_action: | Nucleotides such as Adenosine-5--Monophosphate affect a number of immune functions, including the reversal of malnutrition and starvation-induced immunosuppression, the enhancement of T-cell maturation and function, the enhancement of natural killer cell activity, the improvement of delayed cutaneous hypersensitivity, helping resistance to such infectious agents as Staphylococcus aureus and Candida albicans, and finally the modulation of T-cell responses toward type 1 CD4 helper lymphocytes or Th1 cells. Studies have shown that mice fed a nucleotide-free diet have both impaired humoral and cellular immune responses. The addition of dietary nucleotides normalizes both types of responses. RNA, a delivery form of nucleotides, and ribonucleotides were used in these studies. The mechanism of the immune-enhancing activity of nucleic acids/nucleotides is not clear. | | Organisms_affected: | Humans and other mammals |
| Species: |
4932 |
| Condition: |
BY4741-3rd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.9200±0.036416 |
| Normalized OD Score: sc h |
0.8662±0.0317314 |
| Z-Score: |
-5.3484±0.998255 |
| p-Value: |
0.00000172202 |
| Z-Factor: |
-5.65929 |
| Fitness Defect: |
13.272 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 1|F5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09±0.00250 | | Plate DMSO Control (-): | 0.9574999999999999±0.01026 | | Plate Z-Factor: | 0.9662 |
| png ps pdf |
| 224 |
[5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid |
| 6083 |
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid |
| 20712 |
disodium (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(phosphonatooxymethyl)oxolane-3,4-diol |
| 26054 |
sodium (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[(hydroxy-oxido-phosphoryl)oxymethyl]oxolane-3,4-diol |
| 34768 |
[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxyphosphonic acid |
| 37080 |
potassium (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[(hydroxy-oxido-phosphoryl)oxymethyl]oxolane-3,4-diol |
| internal high similarity DBLink | Rows returned: 1 | |
|