| Compound Information | SONAR Target prediction |  | Name: | THEOBROMINE |  | Unique Identifier: | SPE01500649  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 172.101 g/mol |  | X log p: | 1.673  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 52.98 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | Cn1cnc2N(C)C(=O)NC(=O)c12 |  | Class: | alkaloid |  | Source: | Camelia, Theobroma, Cola spp |  | Therapeutics: | diuretic, bronchodilator, cardiotonic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SWC5 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6541±0.017607 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9852±0.0262854 | 
	 
	
		| Z-Score: | 
		-0.7206±1.2569 | 
	 
	
		| p-Value: | 
		0.487002 | 
	 
	
		| Z-Factor: | 
		-8.85362 | 
	 
	
		| Fitness Defect: | 
		0.7195 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 25|H2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.10 Celcius |  | Date: | 2008-06-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.039675±0.00041 |  | Plate DMSO Control (-): | 0.6616±0.01561 |  | Plate Z-Factor: | 0.9318 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 5429 | 
		3,7-dimethylpurine-2,6-dione | 
	 
	
		| 24700 | 
		sodium 3,7-dimethylpurine-2,6-dione | 
	 
	
		| 205018 | 
		3,7-dimethylpurine-2,6-dione hydroiodide | 
	 
	
		| 3031945 | 
		lithium 3,7-dimethylpurine-2,6-dione | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  active | Cluster 9605 | Additional Members: 8 | Rows returned: 0 |  |  
  
 |