| Compound Information | SONAR Target prediction | | Name: | TRIMEPRAZINE TARTRATE | | Unique Identifier: | SPE01500593 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 420.311 g/mol | | X log p: | 17.975 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 31.78 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CN(C)C)CN1c2ccccc2Sc2ccccc12.OC(C(O)C(O)=O)C(O)=O | | Source: | synthetic | | Therapeutics: | antipruritic |
| Species: |
4932 |
| Condition: |
SPE01503422 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1197±0.0325976 |
| Normalized OD Score: sc h |
1.6806±0.0821924 |
| Z-Score: |
8.4910±0.362486 |
| p-Value: |
9.112e-17 |
| Z-Factor: |
-4.01936 |
| Fitness Defect: |
36.9344 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 2|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2007-03-22 YYYY-MM-DD | | Plate CH Control (+): | 0.039975±0.00174 | | Plate DMSO Control (-): | 0.08505±0.32817 | | Plate Z-Factor: | -2.4726 |
|  png
ps
pdf |
| DBLink | Rows returned: 5 | |
| 441236 |
(2R,3R)-2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
| 5702128 |
2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
| 6419902 |
2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
| 6451200 |
(2R,3R)-2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
| 6604495 |
(2R,3S)-2,3-dihydroxybutanedioic acid; (2S)-N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 15250 | Additional Members: 5 | Rows returned: 1 | |
|
