| Compound Information | SONAR Target prediction |  | Name: | TRIMEPRAZINE TARTRATE |  | Unique Identifier: | SPE01500593  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 420.311 g/mol |  | X log p: | 17.975  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 31.78 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(CN(C)C)CN1c2ccccc2Sc2ccccc12.OC(C(O)C(O)=O)C(O)=O |  | Source: | synthetic |  | Therapeutics: | antipruritic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		DCG1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6814±0.000707107 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9890±0.00727681 | 
	 
	
		| Z-Score: | 
		-0.6018±0.393222 | 
	 
	
		| p-Value: | 
		0.562532 | 
	 
	
		| Z-Factor: | 
		-12.7461 | 
	 
	
		| Fitness Defect: | 
		0.5753 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 19|G9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.00 Celcius |  | Date: | 2007-10-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.039925±0.00024 |  | Plate DMSO Control (-): | 0.6725000000000001±0.12670 |  | Plate Z-Factor: | 0.3549 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 5 |  |  
 
	
		| 441236 | 
		(2R,3R)-2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine | 
	 
	
		| 5702128 | 
		2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine | 
	 
	
		| 6419902 | 
		2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine | 
	 
	
		| 6451200 | 
		(2R,3R)-2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine | 
	 
	
		| 6604495 | 
		(2R,3S)-2,3-dihydroxybutanedioic acid; (2S)-N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 15250 | Additional Members: 5 | Rows returned: 1 |  |   
 
 |