Compound Information | SONAR Target prediction | Name: | TRIMEPRAZINE TARTRATE | Unique Identifier: | SPE01500593 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 420.311 g/mol | X log p: | 17.975 (online calculus) | Lipinksi Failures | 1 | TPSA | 31.78 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CN(C)C)CN1c2ccccc2Sc2ccccc12.OC(C(O)C(O)=O)C(O)=O | Source: | synthetic | Therapeutics: | antipruritic |
Species: |
4932 |
Condition: |
CDC73 |
Replicates: |
2 |
Raw OD Value: r im |
0.3638±0.0475883 |
Normalized OD Score: sc h |
0.8744±0.0204826 |
Z-Score: |
-3.1534±0.35041 |
p-Value: |
0.00216816 |
Z-Factor: |
-10.9158 |
Fitness Defect: |
6.1339 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 19|G9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2007-09-19 YYYY-MM-DD | Plate CH Control (+): | 0.039975±0.00031 | Plate DMSO Control (-): | 0.39942500000000003±0.08627 | Plate Z-Factor: | 0.2020 |
| png ps pdf |
DBLink | Rows returned: 5 | |
441236 |
(2R,3R)-2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
5702128 |
2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
6419902 |
2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
6451200 |
(2R,3R)-2,3-dihydroxybutanedioic acid; N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
6604495 |
(2R,3S)-2,3-dihydroxybutanedioic acid; (2S)-N,N,2-trimethyl-3-phenothiazin-10-yl-propan-1-amine |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 15250 | Additional Members: 5 | Rows returned: 1 | |
|