Compound Information | SONAR Target prediction |
Name: | TRIFLUOPERAZINE HYDROCHLORIDE |
Unique Identifier: | SPE01500591 |
MolClass: | Checkout models in ver1.5 and ver1.0 |
Molecular Formula: | |
Molecular Weight: | 454.212 g/mol |
X log p: | 17.027 (online calculus) |
Lipinksi Failures | 1 |
TPSA | 35.02 |
Hydrogen Bond Donor Count: | 0 |
Hydrogen Bond Acceptors Count: | 3 |
Rotatable Bond Count: | 5 |
Canonical Smiles: | Cl.Cl.CN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1 |
Source: | synthetic |
Therapeutics: | antipsychotic |
Generic_name: | Trifluoperazine |
Chemical_iupac_name: | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine |
Drug_type: | Approved Drug |
Pharmgkb_id: | PA451771 |
Kegg_compound_id: | C07168 |
Drugbank_id: | APRD00173 |
Logp: | 5.366 |
Cas_registry_number: | 117-89-5 |
Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C117895&Index=0&Type=Mass&Large=on |
Drug_category: | Antipsychotics; Antiemetics; Phenothiazines; ATC:N05AB06 |
Indication: | For the treatment of anxiety disorders, depressive symptoms secondary to anxiety and agitation. |
Pharmacology: | Trifluoperazine is a trifluoro-methyl phenothiazine derivative intended for the management of schizophrenia and other psychotic disorders. Trifluoperazine has not been shown effective in the management of behaviorial complications in patients with mental retardation. |
Mechanism_of_action: | Trifluoperazine blocks postsynaptic mesolimbic dopaminergic D1 and D2 receptors in the brain; depresses the release of hypothalamic and hypophyseal hormones and is believed to depress the reticular activating system thus affecting basal metabolism, body temperature, wakefulness, vasomotor tone, and emesis. |
Organisms_affected: | Humans and other mammals |
5566 |
10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
28690 |
10-[3-(4-cyclopropylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |
66064 |
10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine dihydrochloride |
168895 |
10-[3-(4-cyclopropylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine dihydrochloride |
213344 |
10-[3-(4,4-dimethyl-2,3,5,6-tetrahydropyrazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine iodide |
213345 |
10-[3-(4,4-dimethyl-2,3,5,6-tetrahydropyrazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine |