Compound Information | SONAR Target prediction | Name: | TRIAMCINOLONE DIACETATE | Unique Identifier: | SPE01500588 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 447.261 g/mol | X log p: | 3.975 (online calculus) | Lipinksi Failures | 0 | TPSA | 86.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)C(CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)OC(C)=O | Source: | semisynthetic | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
ABP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6876±0.0113137 |
Normalized OD Score: sc h |
0.9868±0.0125538 |
Z-Score: |
-0.6654±0.614082 |
p-Value: |
0.544344 |
Z-Factor: |
-4.51335 |
Fitness Defect: |
0.6082 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 3|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.00 Celcius | Date: | 2007-12-20 YYYY-MM-DD | Plate CH Control (+): | 0.0417±0.00053 | Plate DMSO Control (-): | 0.67005±0.01623 | Plate Z-Factor: | 0.9262 |
| png ps pdf |
7061379 |
[2-[(8R,9R,10S,11R,13S,14S,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061380 |
[2-[(8R,9R,10S,11R,13S,14R,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
|