| Compound Information | SONAR Target prediction |  | Name: | TRIAMCINOLONE DIACETATE |  | Unique Identifier: | SPE01500588  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 447.261 g/mol |  | X log p: | 3.975  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 86.74 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 8 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC(=O)OCC(=O)C1(O)C(CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)OC(C)=O |  | Source: | semisynthetic |  | Therapeutics: | antiinflammatory |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SER1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5623±0.0104652 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9861±0.00447344 | 
	 
	
		| Z-Score: | 
		-0.4351±0.128972 | 
	 
	
		| p-Value: | 
		0.66483 | 
	 
	
		| Z-Factor: | 
		-13.5639 | 
	 
	
		| Fitness Defect: | 
		0.4082 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 16|A8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.90 Celcius |  | Date: | 2007-09-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.04065±0.00117 |  | Plate DMSO Control (-): | 0.5670999999999999±0.13502 |  | Plate Z-Factor: | 0.1668 |  
  |  png ps pdf |  
 
 
	
		| 7061379 | 
		[2-[(8R,9R,10S,11R,13S,14S,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
	
		| 7061380 | 
		[2-[(8R,9R,10S,11R,13S,14R,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 |  |   
 
 |