Compound Information | SONAR Target prediction | Name: | TRIAMCINOLONE DIACETATE | Unique Identifier: | SPE01500588 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 447.261 g/mol | X log p: | 3.975 (online calculus) | Lipinksi Failures | 0 | TPSA | 86.74 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)C(CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C)OC(C)=O | Source: | semisynthetic | Therapeutics: | antiinflammatory |
Species: |
4932 |
Condition: |
RIC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4704±0.0463155 |
Normalized OD Score: sc h |
0.9947±0.0607381 |
Z-Score: |
0.0012±0.73564 |
p-Value: |
0.602942 |
Z-Factor: |
-122.057 |
Fitness Defect: |
0.5059 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 16|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2006-03-17 YYYY-MM-DD | Plate CH Control (+): | 0.0394±0.00123 | Plate DMSO Control (-): | 0.46187500000000004±0.01437 | Plate Z-Factor: | 0.8626 |
| png ps pdf |
6216 |
[2-[(8S,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
539244 |
[2-(16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[ a]phenanthren-17-yl)-2-oxo-ethyl] acetate |
5702127 |
[2-[(9R,10S,11S,13S,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,1 5,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
6546954 |
[2-[(8S,9S,10S,11R,13R,14S,16S,17R)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7059643 |
[2-[(8R,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061378 |
[2-[(8R,9R,10S,11S,13S,14R,16R,17S)-16-acetyloxy-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11, 12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1865 | Additional Members: 13 | Rows returned: 3 | |
|