| Compound Information | SONAR Target prediction | 
| Name: | TETRACYCLINE HYDROCHLORIDE | 
| Unique Identifier: | SPE01500566 | 
| MolClass: | Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 455.697 g/mol | 
| X log p: | 4.56  (online calculus) | 
| Lipinksi Failures | 0 | 
| TPSA | 54.45 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 10 | 
| Rotatable Bond Count: | 2 | 
| Canonical Smiles: | Cl.CN(C)C1C2CC3C(=C(O)C2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)cccc1C3(C)O | 
| Class: | anthraquinone | 
| Source: | Streptomyces spp | 
| Therapeutics: | antibacterial, antiamebic, antirickettsial |