| Compound Information | SONAR Target prediction |
| Name: | TETRACYCLINE HYDROCHLORIDE |
| Unique Identifier: | SPE01500566 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 455.697 g/mol |
| X log p: | 4.56 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 10 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Cl.CN(C)C1C2CC3C(=C(O)C2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)cccc1C3(C)O |
| Class: | anthraquinone |
| Source: | Streptomyces spp |
| Therapeutics: | antibacterial, antiamebic, antirickettsial |
| Found: 205 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [205] |
| Species: | 4932 |
| Condition: | AAT2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7066±0.00304056 |
| Normalized OD Score: sc h | 0.9686±0.00731529 |
| Z-Score: | -1.6708±0.425494 |
| p-Value: | 0.10967 |
| Z-Factor: | -1.74632 |
| Fitness Defect: | 2.2103 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 7 | << Back 1 2 |
| SPE01500457 | 0.9825 |
| active | Cluster 12393 | Additional Members: 20 | Rows returned: 4 |
| Prest1244 | 0.490196078431373 |
| Prest1045 | 0.452631578947368 |
| SPE01505684 | 0.452631578947368 |
| Prest60 | 0 |
Service provided by the
Mike Tyers Laboratory