| Compound Information | SONAR Target prediction |  | Name: | TERBUTALINE HEMISULFATE |  | Unique Identifier: | SPE01500558  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 302.197 g/mol |  | X log p: | 5.569  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O |  | Source: | synthetic |  | Therapeutics: | betaadrenergic agonist, bronchodilator |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RSA3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6993±0.0253144 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0084±0.0205918 | 
	 
	
		| Z-Score: | 
		0.3527±0.876495 | 
	 
	
		| p-Value: | 
		0.560106 | 
	 
	
		| Z-Factor: | 
		-6.2634 | 
	 
	
		| Fitness Defect: | 
		0.5796 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 7|G4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.90 Celcius |  | Date: | 2008-04-01 YYYY-MM-DD |  | Plate CH Control (+): | 0.040525000000000005±0.00074 |  | Plate DMSO Control (-): | 0.689125±0.03187 |  | Plate Z-Factor: | 0.8295 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 31620 | 
		[2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate | 
	 
	
		| 441333 | 
		5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid | 
	 
	
		| 441334 | 
		5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid | 
	 
	
		| 657301 | 
		5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |