Compound Information | SONAR Target prediction | Name: | TERBUTALINE HEMISULFATE | Unique Identifier: | SPE01500558 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 302.197 g/mol | X log p: | 5.569 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O | Source: | synthetic | Therapeutics: | betaadrenergic agonist, bronchodilator |
Species: |
4932 |
Condition: |
PPZ1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8053±0.00226274 |
Normalized OD Score: sc h |
0.9918±0.00576986 |
Z-Score: |
-0.4183±0.304871 |
p-Value: |
0.682788 |
Z-Factor: |
-8.99113 |
Fitness Defect: |
0.3816 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 16|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-05-17 YYYY-MM-DD | Plate CH Control (+): | 0.0381±0.00189 | Plate DMSO Control (-): | 0.8054999999999999±0.00886 | Plate Z-Factor: | 0.9622 |
| png ps pdf |
DBLink | Rows returned: 4 | |
31620 |
[2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate |
441333 |
5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid |
441334 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
657301 |
5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |
internal high similarity DBLink | Rows returned: 4 | |
|