| 
 | Compound Information | SONAR Target prediction |  | Name: | TERBUTALINE HEMISULFATE |  | Unique Identifier: | SPE01500558 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 302.197 g/mol |  | X log p: | 5.569  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)(C)NCC(O)c1cc(O)cc(O)c1.OS(O)(=O)=O |  | Source: | synthetic |  | Therapeutics: | betaadrenergic agonist, bronchodilator | 
 
 
	
		| Species: | 4932 |  
		| Condition: | pdr_yCG196 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7440±0.0325269 |  
		| Normalized OD Score: sc h | 0.9825±0.00214528 |  
		| Z-Score: | -0.5836±0.0673182 |  
		| p-Value: | 0.559944 |  
		| Z-Factor: | -7.19745 |  
		| Fitness Defect: | 0.5799 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 5|B6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.09025±0.00866 |  | Plate DMSO Control (-): | 0.94225±0.02535 |  | Plate Z-Factor: | 0.8850 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 4 |  | 
 
	
		| 31620 | [2-(3,5-dihydroxyphenyl)-2-hydroxy-ethyl]-tert-butyl-azanium sulfate |  
		| 441333 | 5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,3-diol; sulfuric acid |  
		| 441334 | 5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |  
		| 657301 | 5-[1-hydroxy-2-(tert-butylamino)ethyl]benzene-1,3-diol; sulfuric acid |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 | active | Cluster 17428 | Additional Members: 9 | Rows returned: 0 |  | 
 
 |