Compound Information | SONAR Target prediction | Name: | TAMOXIFEN CITRATE | Unique Identifier: | SPE01500557 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 526.344 g/mol | X log p: | 30.746 (online calculus) | Lipinksi Failures | 1 | TPSA | 12.47 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 8 | Canonical Smiles: | CCC(c1ccccc1)=C(c1ccccc1)c1ccc(OCCN(C)C)cc1.OC(=O)CC(O)(CC(O)=O)C(O)=O | Source: | synthetic | Therapeutics: | estrogen antagonist, antineoplastic |
Species: |
4932 |
Condition: |
GYP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.0460±0.000494975 |
Normalized OD Score: sc h |
0.0646±0.000702301 |
Z-Score: |
-51.5920±0.185464 |
p-Value: |
0 |
Z-Factor: |
0.921433 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 6|B3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2008-06-10 YYYY-MM-DD | Plate CH Control (+): | 0.041499999999999995±0.00062 | Plate DMSO Control (-): | 0.7008000000000001±0.01672 | Plate Z-Factor: | 0.9243 |
| png ps pdf |
DBLink | Rows returned: 3 | |
23672 |
2-[4-(1,2-diphenylbut-1-enyl)phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
2733525 |
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
3033630 |
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 3471 | Additional Members: 6 | Rows returned: 3 | |
|