| 
 | Compound Information | SONAR Target prediction |  | Name: | PROPIOMAZINE MALEATE |  | Unique Identifier: | SPE01500512 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C24H28N2O5S |  | Molecular Weight: | 428.333 g/mol |  | X log p: | 15.486  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 48.85 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CCC(=O)c1ccc2Sc3ccccc3N(CC(C)N(C)C)c2c1.OC(=O)C=CC(O)=O |  | Therapeutics: | sedative, hypnotic | 
 
 
	
		| Species: | 4932 |  
		| Condition: | KAR3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6467±0.00544472 |  
		| Normalized OD Score: sc h | 1.0148±0.00115574 |  
		| Z-Score: | 0.6921±0.073063 |  
		| p-Value: | 0.489472 |  
		| Z-Factor: | -10.8072 |  
		| Fitness Defect: | 0.7144 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 16|D3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.50 Celcius |  | Date: | 2007-09-06 YYYY-MM-DD |  | Plate CH Control (+): | 0.042825±0.00152 |  | Plate DMSO Control (-): | 0.6207499999999999±0.11110 |  | Plate Z-Factor: | 0.3927 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 5702109 | but-2-enedioic acid; 1-[10-(2-dimethylaminopropyl)phenothiazin-2-yl]propan-1-one |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | nonactive | Cluster 7451 | Additional Members: 8 | Rows returned: 6 |  | 
 
 |