| Compound Information | SONAR Target prediction | | Name: | PROPIOMAZINE MALEATE | | Unique Identifier: | SPE01500512 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C24H28N2O5S | | Molecular Weight: | 428.333 g/mol | | X log p: | 15.486 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 48.85 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CCC(=O)c1ccc2Sc3ccccc3N(CC(C)N(C)C)c2c1.OC(=O)C=CC(O)=O | | Therapeutics: | sedative, hypnotic |
| Species: |
4932 |
| Condition: |
GIM3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7919±0.0199404 |
| Normalized OD Score: sc h |
0.9798±0.0146084 |
| Z-Score: |
-0.6217±0.416366 |
| p-Value: |
0.551524 |
| Z-Factor: |
-3.63879 |
| Fitness Defect: |
0.5951 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 16|D3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.00 Celcius | | Date: | 2006-03-15 YYYY-MM-DD | | Plate CH Control (+): | 0.03815±0.00203 | | Plate DMSO Control (-): | 0.7838499999999999±0.01459 | | Plate Z-Factor: | 0.9437 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5702109 |
but-2-enedioic acid; 1-[10-(2-dimethylaminopropyl)phenothiazin-2-yl]propan-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7451 | Additional Members: 8 | Rows returned: 2 | |
|