| Compound Information | SONAR Target prediction |  | Name: | PROPIOMAZINE MALEATE |  | Unique Identifier: | SPE01500512  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C24H28N2O5S |  | Molecular Weight: | 428.333 g/mol |  | X log p: | 15.486  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 48.85 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | CCC(=O)c1ccc2Sc3ccccc3N(CC(C)N(C)C)c2c1.OC(=O)C=CC(O)=O |  | Therapeutics: | sedative, hypnotic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		GCN5 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.2276±0.010748 | 
	 
	
		| Normalized OD Score: sc h | 
		0.8064±0.0122553 | 
	 
	
		| Z-Score: | 
		-3.3178±0.187353 | 
	 
	
		| p-Value: | 
		0.00100304 | 
	 
	
		| Z-Factor: | 
		-4.43759 | 
	 
	
		| Fitness Defect: | 
		6.9047 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 16|D3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.40 Celcius |  | Date: | 2007-10-30 YYYY-MM-DD |  | Plate CH Control (+): | 0.0409±0.00021 |  | Plate DMSO Control (-): | 0.2836±0.06712 |  | Plate Z-Factor: | 0.1124 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 5702109 | 
		but-2-enedioic acid; 1-[10-(2-dimethylaminopropyl)phenothiazin-2-yl]propan-1-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 7451 | Additional Members: 8 | Rows returned: 2 |  |   
 
 |