| Compound Information | SONAR Target prediction | 
| Name: | PROMETHAZINE HYDROCHLORIDE | 
| Unique Identifier: | SPE01500510  | 
| MolClass: |  Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 299.714 g/mol | 
| X log p: | 17.895  (online calculus) | 
| Lipinksi Failures | 1 | 
| TPSA | 31.78 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 2 | 
| Rotatable Bond Count: | 3 | 
| Canonical Smiles: | Cl.CC(CN1c2ccccc2Sc2ccccc12)N(C)C | 
| Source: | synthetic | 
| Therapeutics: | antihistaminic | 
| Generic_name: | Promethazine | 
| Chemical_iupac_name: | N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine | 
| Drug_type: | Approved Drug | 
| Kegg_compound_id: | C07404 | 
| Drugbank_id: | APRD00601 | 
| Melting_point: | 60oC | 
| H2o_solubility: | Freely soluble | 
| Logp: | 4.946 | 
| Cas_registry_number: | 60-87-7 | 
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C60877&Index=0&Type=Mass&Large=on | 
| Drug_category: | Anti-allergic Agents; Antipruritics; Phenothiazine Derivatives; ATC:D04AA10; ATC:R06AD02; ATC:R06AD05 | 
| Indication: | For the treatment of allergic disorders, itching, nausea and vomiting. | 
| Pharmacology: | Promethazine, a phenothiazine, is an H1-antagonist with anticholinergic, sedative, and antiemetic effects and some local anesthetic properties. Promethazine is used as an antiemetic or to prevent motion sickness. | 
| Mechanism_of_action: | Like other H1-antagonists, promethazine competes with free histamine for binding at H1-receptor sites in the GI tract, uterus, large blood vessels, and bronchial muscle. The relief of nausea appears to be related to central anticholinergic actions and may implicate activity on the medullary chemoreceptor trigger zone. | 
| Organisms_affected: | Humans and other mammals |