| Compound Information | SONAR Target prediction |
| Name: | PROCHLORPERAZINE EDISYLATE |
| Unique Identifier: | SPE01500505 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 533.903 g/mol |
| X log p: | 16.724 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.02 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | CN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc23)CC1.OS(=O)(=O)CCS(O)(=O)=O |
| Source: | synthetic |
| Therapeutics: | antiemetic, antipsychotic, treatment of vertigo |
| Found: 102 active | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [102] |
| Species: | 4932 |
| Condition: | PEP5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.0510±0.000494975 |
| Normalized OD Score: sc h | 0.0744±0.000868305 |
| Z-Score: | -51.3273±1.1982 |
| p-Value: | 0 |
| Z-Factor: | 0.909365 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Toxic |
| ps |
| DBLink | Rows returned: 1 |
| 91499 | 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine; ethane-1,2-disulfonic acid |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 6041 | Additional Members: 22 | Rows returned: 19 | 1 2 3 4 Next >> |
| Prest853 | 0.555555555555556 |
| LAT002B04 | 0.5375 |
| SPE01500575 | 0.5375 |
| Prest437 | 0.5375 |
| LOPAC 00320 | 0.5375 |
| SPE01503936 | 0.452054794520548 |
Service provided by the
Mike Tyers Laboratory