Compound Information | SONAR Target prediction | Name: | PREDNISOLONE ACETATE | Unique Identifier: | SPE01500497 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 372.242 g/mol | X log p: | 3.68 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
HSC82 |
Replicates: |
2 |
Raw OD Value: r im |
0.6964±0.00770746 |
Normalized OD Score: sc h |
0.9800±0.0024901 |
Z-Score: |
-1.1198±0.203977 |
p-Value: |
0.26773 |
Z-Factor: |
-4.84577 |
Fitness Defect: |
1.3178 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 2|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.04095±0.00078 | Plate DMSO Control (-): | 0.7078749999999999±0.02015 | Plate Z-Factor: | 0.9021 |
| png ps pdf |
7059634 |
[2-[(6S,8S,9R,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061371 |
[2-[(6S,8S,9R,10S,11S,13S,14R,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061372 |
[2-[(6S,8S,9R,10S,11R,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7061373 |
[2-[(6S,8S,9R,10S,11R,13S,14R,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 17014 | Additional Members: 17 | Rows returned: 2 | |
|