Compound Information | SONAR Target prediction | Name: | PREDNISOLONE ACETATE | Unique Identifier: | SPE01500497 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 372.242 g/mol | X log p: | 3.68 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
PDE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8200±0.00282843 |
Normalized OD Score: sc h |
1.0060±0.00296457 |
Z-Score: |
0.2199±0.114874 |
p-Value: |
0.826524 |
Z-Factor: |
-13.3173 |
Fitness Defect: |
0.1905 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 16|D10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2006-05-11 YYYY-MM-DD | Plate CH Control (+): | 0.038400000000000004±0.00223 | Plate DMSO Control (-): | 0.7964±0.01389 | Plate Z-Factor: | 0.9372 |
| png ps pdf |
7001033 |
[2-[(8R,9S,10S,11S,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7048760 |
[2-[(8S,9R,10R,11S,13S,14S,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7048761 |
[2-[(8S,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7048762 |
[2-[(8S,9R,10R,11S,13S,14R,17S)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7048763 |
[2-[(8S,9R,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
7059632 |
[2-[(8R,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 17014 | Additional Members: 17 | Rows returned: 2 | |
|