Compound Information | SONAR Target prediction | Name: | PREDNISOLONE ACETATE | Unique Identifier: | SPE01500497 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 372.242 g/mol | X log p: | 3.68 (online calculus) | Lipinksi Failures | 0 | TPSA | 60.44 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C | Source: | semisynthetic | Therapeutics: | glucocorticoid |
Species: |
4932 |
Condition: |
FET3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6813±0.00579828 |
Normalized OD Score: sc h |
0.9921±0.00125831 |
Z-Score: |
-0.3378±0.070674 |
p-Value: |
0.735812 |
Z-Factor: |
-37.72 |
Fitness Defect: |
0.3068 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 2|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.20 Celcius | Date: | 2008-01-10 YYYY-MM-DD | Plate CH Control (+): | 0.040999999999999995±0.00082 | Plate DMSO Control (-): | 0.6748500000000001±0.01790 | Plate Z-Factor: | 0.9006 |
| png ps pdf |
4895 |
[2-(11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-y l)-2-oxo-ethyl] acetate |
5834 |
[2-[(8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-c yclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
5877 |
[2-[(6S,8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
247936 |
[2-[(6R,8S,9S,10S,11S,13S,14S,17R)-11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydr o-6H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] acetate |
584547 |
[2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1 7-yl)-2-oxo-ethyl] acetate |
5702107 |
[2-[(11S,13S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]ph enanthren-17-yl]-2-oxo-ethyl] acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 17014 | Additional Members: 17 | Rows returned: 2 | |
|