| Compound Information | SONAR Target prediction |
| Name: | PIROXICAM |
| Unique Identifier: | SPE01500491 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 318.244 g/mol |
| X log p: | 16.081 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 75.19 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | CN1C(C(=O)Nc2ccccn2)=C(O)c2ccccc2S1(=O)=O |
| Source: | synthetic |
| Therapeutics: | antiinflammatory |
| Found: 12 active | as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | HSP104 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6633±0.00205061 |
| Normalized OD Score: sc h | 0.9301±0.00526077 |
| Z-Score: | -4.0130±0.39816 |
| p-Value: | 0.000103957 |
| Z-Factor: | -0.0328418 |
| Fitness Defect: | 9.1715 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 1 |
| LOPAC 01144 | 1.0000 |
| active | Cluster 16469 | Additional Members: 9 | Rows returned: 4 |
| SPE01504150 | 0.353846153846154 |
| Prest505 | 0.295081967213115 |
| SPE01503242 | 0.295081967213115 |
| Prest573 | 0 |
Service provided by the
Mike Tyers Laboratory