Compound Information | SONAR Target prediction | Name: | PHENAZOPYRIDINE HYDROCHLORIDE | Unique Identifier: | SPE01500473 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 237.604 g/mol | X log p: | 13.78 (online calculus) | Lipinksi Failures | 1 | TPSA | 37.08 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 2 | Canonical Smiles: | Cl.Nc1ccc(N=Nc2ccccc2)c(N)n1 | Source: | synthetic | Therapeutics: | analgesic |
Species: |
4932 |
Condition: |
SWC5 |
Replicates: |
2 |
Raw OD Value: r im |
0.4908±0.0520431 |
Normalized OD Score: sc h |
0.7418±0.0631211 |
Z-Score: |
-11.5753±1.88193 |
p-Value: |
6.26098e-25 |
Z-Factor: |
-0.0382029 |
Fitness Defect: |
55.7303 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 4|D11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2008-06-19 YYYY-MM-DD | Plate CH Control (+): | 0.039425±0.00052 | Plate DMSO Control (-): | 0.635525±0.01782 | Plate Z-Factor: | 0.8867 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4756 |
3-phenyldiazenylpyridine-2,6-diamine |
8691 |
3-phenyldiazenylpyridine-2,6-diamine hydrochloride |
657215 |
hydrogen(+1) cation; 3-phenyldiazenylpyridine-2,6-diamine; chloride |
7048748 |
(2,6-diaminopyridin-3-yl)-phenylimino-azanium |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 15305 | Additional Members: 2 | Rows returned: 0 | |
|