| Compound Information | SONAR Target prediction | | Name: | PHENAZOPYRIDINE HYDROCHLORIDE | | Unique Identifier: | SPE01500473 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 237.604 g/mol | | X log p: | 13.78 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 37.08 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Cl.Nc1ccc(N=Nc2ccccc2)c(N)n1 | | Source: | synthetic | | Therapeutics: | analgesic |
| Species: |
4932 |
| Condition: |
MRC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5493±0.0280014 |
| Normalized OD Score: sc h |
0.7881±0.0300498 |
| Z-Score: |
-10.6333±1.16215 |
| p-Value: |
5.01884e-23 |
| Z-Factor: |
-0.436878 |
| Fitness Defect: |
51.3463 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 4|D11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.00 Celcius | | Date: | 2008-01-15 YYYY-MM-DD | | Plate CH Control (+): | 0.044425±0.00102 | | Plate DMSO Control (-): | 0.66385±0.04262 | | Plate Z-Factor: | 0.7478 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 4756 |
3-phenyldiazenylpyridine-2,6-diamine |
| 8691 |
3-phenyldiazenylpyridine-2,6-diamine hydrochloride |
| 657215 |
hydrogen(+1) cation; 3-phenyldiazenylpyridine-2,6-diamine; chloride |
| 7048748 |
(2,6-diaminopyridin-3-yl)-phenylimino-azanium |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 15305 | Additional Members: 2 | Rows returned: 1 | |
|
