| Compound Information | SONAR Target prediction |
| Name: | OXYTETRACYCLINE |
| Unique Identifier: | SPE01500457 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 471.696 g/mol |
| X log p: | 4.063 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 54.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 11 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Cl.CN(C)C1C2C(O)C3C(=C(O)C2(O)C(=O)C(C(N)=O)=C1O)C(=O)c1c(O)cccc1C3(C) O |
| Source: | Streptomyces rimosus |
| Therapeutics: | antibacterial |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 61 62 63 64 65 66 67 68 69 70 Next >> [205] |
| Species: | 4932 |
| Condition: | SKT5 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7067±0.00304056 |
| Normalized OD Score: sc h | 1.0185±0.000195586 |
| Z-Score: | 0.9185±0.013985 |
| p-Value: | 0.358404 |
| Z-Factor: | -1.4129 |
| Fitness Defect: | 1.0261 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 7 | << Back 1 2 |
| SPE01500566 | 0.9825 |
| active | Cluster 2358 | Additional Members: 14 | Rows returned: 5 |
| Prest588 | 0.465909090909091 |
| SPE01501118 | 0.465909090909091 |
| Prest1251 | 0.406976744186046 |
| Prest1072 | 0 |
| SPE01500266 | 0 |
Service provided by the
Mike Tyers Laboratory