| Compound Information | SONAR Target prediction |  | Name: | OXYBENZONE |  | Unique Identifier: | SPE01500451  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 216.148 g/mol |  | X log p: | 17.116  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1 |  | Source: | synthetic |  | Therapeutics: | ultraviolet screen |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SAC3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.3133±0.0272943 | 
	 
	
		| Normalized OD Score: sc h | 
		0.6714±0.0185045 | 
	 
	
		| Z-Score: | 
		-9.6559±0.773786 | 
	 
	
		| p-Value: | 
		4.16878e-20 | 
	 
	
		| Z-Factor: | 
		0.524949 | 
	 
	
		| Fitness Defect: | 
		44.6241 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 4|G7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.50 Celcius |  | Date: | 2008-05-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.041125±0.00065 |  | Plate DMSO Control (-): | 0.4445±0.01454 |  | Plate Z-Factor: | 0.8993 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 4632 | 
		(2-hydroxy-4-methoxy-phenyl)-phenyl-methanone | 
	 
	
		| 10175 | 
		(2,6-dihydroxy-4-methoxy-phenyl)-phenyl-methanone | 
	 
	
		| 96154 | 
		(2-hydroxy-4-methoxy-phenyl)-(4-methoxyphenyl)methanone | 
	 
	
		| 282356 | 
		(2-hydroxy-4-methoxy-phenyl)-(4-hydroxyphenyl)methanone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  nonactive | Cluster 9214 | Additional Members: 5 | Rows returned: 2 |  |   
 
 |