| Compound Information | SONAR Target prediction | | Name: | OXYBENZONE | | Unique Identifier: | SPE01500451 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 216.148 g/mol | | X log p: | 17.116 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1 | | Source: | synthetic | | Therapeutics: | ultraviolet screen |
| Species: |
4932 |
| Condition: |
TOP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2042±0.030547 |
| Normalized OD Score: sc h |
0.4736±0.0648645 |
| Z-Score: |
-4.5983±0.85119 |
| p-Value: |
0.0000322584 |
| Z-Factor: |
0.372897 |
| Fitness Defect: |
10.3417 |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 17|B10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2006-04-25 YYYY-MM-DD | | Plate CH Control (+): | 0.0394±0.00174 | | Plate DMSO Control (-): | 0.41655±0.01859 | | Plate Z-Factor: | 0.8441 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 4632 |
(2-hydroxy-4-methoxy-phenyl)-phenyl-methanone |
| 10175 |
(2,6-dihydroxy-4-methoxy-phenyl)-phenyl-methanone |
| 96154 |
(2-hydroxy-4-methoxy-phenyl)-(4-methoxyphenyl)methanone |
| 282356 |
(2-hydroxy-4-methoxy-phenyl)-(4-hydroxyphenyl)methanone |
| internal high similarity DBLink | Rows returned: 3 | |
| nonactive | Cluster 9214 | Additional Members: 5 | Rows returned: 2 | |
|
