Compound Information | SONAR Target prediction | Name: | OXYBENZONE | Unique Identifier: | SPE01500451 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 216.148 g/mol | X log p: | 17.116 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1 | Source: | synthetic | Therapeutics: | ultraviolet screen |
Species: |
4932 |
Condition: |
BIK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6137±0.00735391 |
Normalized OD Score: sc h |
0.9197±0.00988592 |
Z-Score: |
-3.5218±0.461407 |
p-Value: |
0.000757372 |
Z-Factor: |
-1.89863 |
Fitness Defect: |
7.1857 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 17|B10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2007-11-08 YYYY-MM-DD | Plate CH Control (+): | 0.0408±0.00059 | Plate DMSO Control (-): | 0.656025±0.03811 | Plate Z-Factor: | 0.7970 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4632 |
(2-hydroxy-4-methoxy-phenyl)-phenyl-methanone |
10175 |
(2,6-dihydroxy-4-methoxy-phenyl)-phenyl-methanone |
96154 |
(2-hydroxy-4-methoxy-phenyl)-(4-methoxyphenyl)methanone |
282356 |
(2-hydroxy-4-methoxy-phenyl)-(4-hydroxyphenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 9214 | Additional Members: 5 | Rows returned: 1 | |
|