Compound Information | SONAR Target prediction | Name: | OXYBENZONE | Unique Identifier: | SPE01500451 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 216.148 g/mol | X log p: | 17.116 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1 | Source: | synthetic | Therapeutics: | ultraviolet screen |
Species: |
4932 |
Condition: |
CIN8 |
Replicates: |
2 |
Raw OD Value: r im |
0.5527±0.00869741 |
Normalized OD Score: sc h |
0.9395±0.00888765 |
Z-Score: |
-3.2964±0.437652 |
p-Value: |
0.00156478 |
Z-Factor: |
-0.00687408 |
Fitness Defect: |
6.46 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 4|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.70 Celcius | Date: | 2008-02-06 YYYY-MM-DD | Plate CH Control (+): | 0.04075±0.00057 | Plate DMSO Control (-): | 0.655225±0.01698 | Plate Z-Factor: | 0.9201 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4632 |
(2-hydroxy-4-methoxy-phenyl)-phenyl-methanone |
10175 |
(2,6-dihydroxy-4-methoxy-phenyl)-phenyl-methanone |
96154 |
(2-hydroxy-4-methoxy-phenyl)-(4-methoxyphenyl)methanone |
282356 |
(2-hydroxy-4-methoxy-phenyl)-(4-hydroxyphenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 9214 | Additional Members: 5 | Rows returned: 1 | |
|