Compound Information | SONAR Target prediction | Name: | OXYBENZONE | Unique Identifier: | SPE01500451 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 216.148 g/mol | X log p: | 17.116 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)c1ccccc1 | Source: | synthetic | Therapeutics: | ultraviolet screen |
Species: |
4932 |
Condition: |
SPE01500521 |
Replicates: |
2 |
Raw OD Value: r im |
0.0626±0.00346482 |
Normalized OD Score: sc h |
0.8778±0.00245627 |
Z-Score: |
-1.6710±0.0191012 |
p-Value: |
0.094759 |
Z-Factor: |
-2.70491 |
Fitness Defect: |
2.3564 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|A4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2007-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.048549999999999996±0.00139 | Plate DMSO Control (-): | 0.07655±0.29189 | Plate Z-Factor: | -2.4474 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4632 |
(2-hydroxy-4-methoxy-phenyl)-phenyl-methanone |
10175 |
(2,6-dihydroxy-4-methoxy-phenyl)-phenyl-methanone |
96154 |
(2-hydroxy-4-methoxy-phenyl)-(4-methoxyphenyl)methanone |
282356 |
(2-hydroxy-4-methoxy-phenyl)-(4-hydroxyphenyl)methanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 9214 | Additional Members: 5 | Rows returned: 1 | |
|