Compound Information | SONAR Target prediction | Name: | OXACILLIN SODIUM | Unique Identifier: | SPE01500448 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 406.284 g/mol | X log p: | 9.308 (online calculus) | Lipinksi Failures | 1 | TPSA | 124.4 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 5 | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(C)onc1c1ccccc1)C2=O | Source: | semisynthetic | Therapeutics: | antibacterial |
Species: |
4932 |
Condition: |
CTF18 |
Replicates: |
2 |
Raw OD Value: r im |
0.6044±0.00516188 |
Normalized OD Score: sc h |
1.0065±0.00207024 |
Z-Score: |
0.3004±0.128124 |
p-Value: |
0.764826 |
Z-Factor: |
-11.4573 |
Fitness Defect: |
0.2681 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 17|C9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-11-01 YYYY-MM-DD | Plate CH Control (+): | 0.04235±0.00088 | Plate DMSO Control (-): | 0.5902499999999999±0.03405 | Plate Z-Factor: | 0.8112 |
| png ps pdf |
4607 |
3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
4608 |
3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylic acid |
6196 |
(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylic acid |
23663 |
sodium 3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
64714 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
441399 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate hydrate |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 3276 | Additional Members: 16 | Rows returned: 0 | |
|