Compound Information | SONAR Target prediction | Name: | OXACILLIN SODIUM | Unique Identifier: | SPE01500448 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 406.284 g/mol | X log p: | 9.308 (online calculus) | Lipinksi Failures | 1 | TPSA | 124.4 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 5 | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(C)onc1c1ccccc1)C2=O | Source: | semisynthetic | Therapeutics: | antibacterial |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.5439±0.0114551 |
Normalized OD Score: sc h |
1.0441±0.0142434 |
Z-Score: |
0.4231±0.0851845 |
p-Value: |
0.67275 |
Z-Factor: |
-3.1758 |
Fitness Defect: |
0.3964 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 19|B6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2008-06-05 YYYY-MM-DD | Plate CH Control (+): | 0.040725000000000004±0.00042 | Plate DMSO Control (-): | 0.5124500000000001±0.01653 | Plate Z-Factor: | 0.9053 |
| png ps pdf |
4607 |
3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
4608 |
3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylic acid |
6196 |
(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylic acid |
23663 |
sodium 3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
64714 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
441399 |
sodium (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate hydrate |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 3276 | Additional Members: 16 | Rows returned: 0 | |
|