| Compound Information | SONAR Target prediction | | Name: | OXACILLIN SODIUM | | Unique Identifier: | SPE01500448 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 406.284 g/mol | | X log p: | 9.308 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 124.4 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(C)onc1c1ccccc1)C2=O | | Source: | semisynthetic | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
ARD1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4913±0.0120915 |
| Normalized OD Score: sc h |
1.2205±0.0196088 |
| Z-Score: |
5.7463±0.508463 |
| p-Value: |
0.000000036377 |
| Z-Factor: |
0.134594 |
| Fitness Defect: |
17.1293 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 19|B6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2008-07-10 YYYY-MM-DD | | Plate CH Control (+): | 0.040625±0.00039 | | Plate DMSO Control (-): | 0.37829999999999997±0.01634 | | Plate Z-Factor: | 0.8597 |
| png ps pdf |
| 7048730 |
(2R,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
| 7048731 |
(2R,5S,6S)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
| 7048732 |
(2R,5S,6S)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylic acid |
| 16051952 |
sodium (2R,5R,6S)-3,3-dimethyl-6-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3. 2.0]heptane-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 3276 | Additional Members: 16 | Rows returned: 0 | |
|