| Compound Information | SONAR Target prediction | | Name: | OXACILLIN SODIUM | | Unique Identifier: | SPE01500448 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 406.284 g/mol | | X log p: | 9.308 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 124.4 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(C)onc1c1ccccc1)C2=O | | Source: | semisynthetic | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8670±0.0101823 |
| Normalized OD Score: sc h |
1.0050±0.0000283899 |
| Z-Score: |
0.1649±0.00347044 |
| p-Value: |
0.869042 |
| Z-Factor: |
-19.3203 |
| Fitness Defect: |
0.1404 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 4|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.10125±0.01065 | | Plate DMSO Control (-): | 0.9452499999999998±0.01954 | | Plate Z-Factor: | 0.8785 |
| png ps pdf |
| 6347540 |
(2R,5R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]hep tane-2-carboxylic acid |
| 6426740 |
(2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
| 6560179 |
(2R,5S,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
| 6560180 |
(2R,5S,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylic acid |
| 6602444 |
(2S,5R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]hep tane-2-carboxylic acid |
| 6993146 |
(2S,5S)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]hep tane-2-carboxylic acid |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 3276 | Additional Members: 16 | Rows returned: 0 | |
|