| Compound Information | SONAR Target prediction |
| Name: | OXACILLIN SODIUM |
| Unique Identifier: | SPE01500448 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 406.284 g/mol |
| X log p: | 9.308 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 124.4 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | [Na+].[O-]C(=O)C1N2C(SC1(C)C)C(NC(=O)c1c(C)onc1c1ccccc1)C2=O |
| Source: | semisynthetic |
| Therapeutics: | antibacterial |
| Found: 1 active | as graph: single | with analogs |
| Species: | 4932 |
| Condition: | ARD1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.4913±0.0120915 |
| Normalized OD Score: sc h | 1.2205±0.0196088 |
| Z-Score: | 5.7463±0.508463 |
| p-Value: | 0.000000036377 |
| Z-Factor: | 0.134594 |
| Fitness Defect: | 17.1293 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 22 | 1 2 3 4 Next >> |
| 4607 | 3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
| 4608 | 3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylic acid |
| 6196 | (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylic acid |
| 23663 | sodium 3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-c arboxylate |
| 64714 | sodium (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate |
| 441399 | sodium (2S,5R,6R)-3,3-dimethyl-6-[(5-methyl-3-phenyl-oxazole-4-carbonyl)amino]-7-oxo-4-thia-1-azabicyclo[3.2.0] heptane-2-carboxylate hydrate |
| internal high similarity DBLink | Rows returned: 2 |
| SPE01500201 | 0.9526 |
| SPE01500238 | 0.9526 |
| active | Cluster 3276 | Additional Members: 16 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory