| Compound Information | SONAR Target prediction |
| Name: | NITROFURANTOIN |
| Unique Identifier: | SPE01500433 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 232.11 g/mol |
| X log p: | 6.195 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 102.11 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | [O-][N+](=O)c1oc(cc1)C=NN1CC(=O)NC1=O |
| Source: | synthetic |
| Therapeutics: | antibacterial |
| Generic_name: | Nitrofurantoin |
| Chemical_iupac_name: | 1-[(5-nitro-2-furyl)methylideneamino]imidazolidine-2,4-dione |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450640 |
| Kegg_compound_id: | C07268 |
| Drugbank_id: | APRD00191 |
| Melting_point: | 263 oC |
| H2o_solubility: | 79.5 mg/L |
| Logp: | -0.04 |
| Isoelectric_point: | 7.2 |
| Cas_registry_number: | 67-20-9 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C67209&Index=0&Type=Mass&Large=on |
| Drug_category: | Anti-Infectives; Anti-Infectives; ATC:J01XE01 |
| Indication: | For the treatment of infection (urinary tract) |
| Pharmacology: | Nitrofurantoin, a nitrofuran antibacterial agent, is available in
microcrystalline and macrocrystalline form to treat urinary tract
infections caused by many gram-negative and some gram-positive bacteria. |
| Mechanism_of_action: | Nitrofurantoin inhibits bacterial acetyl-coenzyme A, interfering with the organism-s
carbohydrate metabolism. The drug also can disrupt bacterial cell wall formation. |
| Organisms_affected: | Gram negative and some gram positive bacteria |
