| Compound Information | SONAR Target prediction |
| Name: | NALOXONE HYDROCHLORIDE |
| Unique Identifier: | SPE01500422 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 341.66 g/mol |
| X log p: | 5.182 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 29.54 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | Cl.Oc1ccc2CC3N(CCC45C(Oc1c24)C(=O)CCC35O)CC=C |
| Class: | alkaloid |
| Source: | synthetic |
| Reference: | Brain Res 839:209 (1999); Brit J Pharmacol 127:605 (1999) |
| Therapeutics: | narcotic antagonist |
| Generic_name: | Naloxone |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450586 |
| Kegg_compound_id: | C07252 |
| Drugbank_id: | APRD00025 |
| Melting_point: | 200 - 205 oC |
| H2o_solubility: | Soluble |
| Logp: | 1.464 |
| Cas_registry_number: | 465-65-6 |
| Drug_category: | Antinarcotic Agents; Depressants; Opiate Antagonists; ATC:V03AB15 |
| Indication: | For the complete or partial reversal of narcotic depression, including respiratory depression, induced by opioids including natural and synthetic narcotics, propoxyphene, methadone and the narcotic-antagonist analgesics: nalbuphine, pentazocine and butorphanol. |
| Pharmacology: | Naloxone is an opiate antagonist and prevents or reverses the effects of opioids including respiratory depression, sedation and hypotension. Also, it can reverse the psychotomimetic and dysphoric effects of agonist-antagonists such as pentazocine. Naloxone is an essentially pure narcotic antagonist, i.e., it does not possess the "agonistic" or morphine-like properties characteristic of other narcotic antagonists; naloxone does not produce respiratory depression, psychotomimetic effects or pupillary constriction. In the absence of narcotics or agonistic effects of other narcotic antagonists, it exhibits essentially no pharmacologic activity. |
| Mechanism_of_action: | While the mechanism of action of naloxone is not fully understood, the preponderance of evidence suggests that naloxone antagonizes the opioid effects by competing for the same receptor sites, especially the opioid mu receptor. Recently, naloxone has been shown to bind all three opioid receptors (mu, kappa and gamma) but the strongest binding is to the mu receptor. |
| Organisms_affected: | Humans and other mammals |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 131 132 133 134 135 136 137 138 139 140 Next >> [205] |
| Species: | 4932 |
| Condition: | DNM1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7000±0.00155563 |
| Normalized OD Score: sc h | 0.9828±0.000159041 |
| Z-Score: | -0.6832±0.0976305 |
| p-Value: | 0.495508 |
| Z-Factor: | -2.41072 |
| Fitness Defect: | 0.7022 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 18 | 1 2 3 Next >> |
| 4425 |
| 186822 |
| 3250242 |
| 5149339 |
| 5284596 |
| 5390107 |
| internal high similarity DBLink | Rows returned: 4 |
| LOPAC 00472 | 0.9234 |
| LOPAC 00457 | 0.9461 |
| SPE01503262 | 0.9461 |
| LOPAC 00456 | 1.0000 |
| active | Cluster 991 | Additional Members: 12 | Rows returned: 2 |
| Prest344 | 0.4125 |
| Prest879 | 0.188405797101449 |
Service provided by the
Mike Tyers Laboratory