| Compound Information | SONAR Target prediction | | Name: | METOPROLOL TARTRATE | | Unique Identifier: | SPE01500411 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 386.205 g/mol | | X log p: | 8.307 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 18.46 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 9 | | Canonical Smiles: | COCCc1ccc(OCC(O)CNC(C)C)cc1.OC(C(O)C(O)=O)C(O)=O | | Source: | synthetic | | Therapeutics: | antihypertensive, antianginal |
| Species: |
4932 |
| Condition: |
DIA2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5826±0.00678822 |
| Normalized OD Score: sc h |
0.9855±0.00912247 |
| Z-Score: |
-0.6730±0.43893 |
| p-Value: |
0.521128 |
| Z-Factor: |
-47.7582 |
| Fitness Defect: |
0.6518 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 18|H7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.90 Celcius | | Date: | 2008-06-18 YYYY-MM-DD | | Plate CH Control (+): | 0.039825±0.00051 | | Plate DMSO Control (-): | 0.579125±0.02507 | | Plate Z-Factor: | 0.8494 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 41860 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| 441308 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| 5702086 |
2,3-dihydroxybutanedioic acid; 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| 6420057 |
2,3-dihydroxybutanedioic acid; 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| 6604132 |
(2S,3R)-2,3-dihydroxybutanedioic acid; (2R)-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| 15991597 |
(2S,3S)-2,3-dihydroxybutanedioic acid; 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| internal high similarity DBLink | Rows returned: 1 | |
|