| Compound Information | SONAR Target prediction |
| Name: | METHYLERGONOVINE MALEATE |
| Unique Identifier: | SPE01500404 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 426.273 g/mol |
| X log p: | 9.761 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 20.31 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 5 |
| Canonical Smiles: | CCC(CO)NC(=O)C1CN(C)C2Cc3cnc4cccc(C2=C1)c34.OC(=O)C=CC(O)=O |
| Source: | semisynthetic |
| Therapeutics: | oxytocic |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 1 2 3 4 5 6 7 8 9 10 Next >> [205] |
| Species: | 4932 |
| Condition: | BIM1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6694±0.00155563 |
| Normalized OD Score: sc h | 0.9925±0.00117718 |
| Z-Score: | -0.3827±0.0282716 |
| p-Value: | 0.702022 |
| Z-Factor: | -76.9485 |
| Fitness Defect: | 0.3538 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 3 |
| LOPAC 00550 | 0.9146 |
| SPE01500277 | 0.9835 |
| LOPAC 01038 | 1.0000 |
| active | Cluster 4543 | Additional Members: 12 | Rows returned: 1 |
| Prest308 | 0.343283582089552 |
Service provided by the
Mike Tyers Laboratory