| Compound Information | SONAR Target prediction |
| Name: | METHYLDOPA |
| Unique Identifier: | SPE01500403 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 198.111 g/mol |
| X log p: | 4.691 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | CC(N)(Cc1ccc(O)c(O)c1)C(O)=O |
| Class: | alkaloid |
| Source: | synthetic |
| Therapeutics: | antihypertensive |
| Generic_name: | Levodopa |
| Chemical_iupac_name: | 2-amino-3-(3,4-dihydroxyphenyl)-propanoic acid |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450213 |
| Kegg_compound_id: | C00355 |
| Drugbank_id: | APRD00309 |
| Melting_point: | 276-278 oC |
| H2o_solubility: | 5000 mg/L |
| Logp: | -2.244 |
| Isoelectric_point: | 2.32 |
| Cas_registry_number: | 59-92-7 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C59927&Index=0&Type=Mass&Large=on |
| Drug_category: | Dopamine Agents; Antiparkinson Agents; Antidyskinetics; ATC:N04BA01; ATC:N04BA04 |
| Indication: | For the treatment of idiopathic Parkinson-s disease (Paralysis Agitans), postencephalitic parkinsonism, symptomatic parkinsonism which may follow injury to the nervous system by carbon monoxide intoxication, and manganese intoxication. |
| Pharmacology: | Levodopa (L-dopa) is used to replace dopamine lost in Parkinson-s disease because dopamine itself cannot cross the blood-brain barrier where its precursor can. However, L-DOPA is converted to dopamine in the periphery as well as in the CNS, so it is administered with a peripheral DDC (dopamine decarboxylase) inhibitor such as carbidopa, without which 90% is metabolised in the gut wall, and with a COMT inhibitor if possible; this prevents about a 5% loss. The form given therapeutically is therefore a prodrug which avoids decarboxylation in the stomach and periphery, can cross the blood-brain barrier, and once in the brain is converted to the neurotransmitter dopamine by the enzyme aromatic-L-amino-acid decarboxylase. |
| Mechanism_of_action: | Striatal dopamine levels in symptomatic Parkinson-s disease are decreased by 60 to 80%, striatal dopaminergic neurotransmission may be enhanced by exogenous supplementation of dopamine through administration of dopamine-s precursor, levodopa. A small percentage of each levodopa dose crosses the blood-brain barrier and is decarboxylated to dopamine. This newly formed dopamine then is available to stimulate dopaminergic receptors, thus compensating for the depleted supply of endogenous dopamine. |
| Organisms_affected: | Humans and other mammals |
| Found: 608 nonactive | as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [608] |
| Species: | 4932 |
| Condition: | SPE01502223 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7279±0.021496 |
| Normalized OD Score: sc h | 0.9830±0.0092198 |
| Z-Score: | -0.7392±0.452174 |
| p-Value: | 0.482254 |
| Z-Factor: | -4.0655 |
| Fitness Defect: | 0.7293 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 18 | 1 2 3 Next >> |
| 836 | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| 4138 | 2-amino-3-(3,4-dihydroxyphenyl)-2-methyl-propanoic acid |
| 6047 | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| 22040 | [1-carboxy-2-(3,4-dihydroxyphenyl)ethyl]azanium chloride |
| 38852 | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methyl-propanoic acid trihydrate |
| 38853 | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methyl-propanoic acid |
| internal high similarity DBLink | Rows returned: 5 |
| RJC 01671 | 0.9474 |
| LOPAC 00283 | 1.0000 |
| LOPAC 00613 | 1.0000 |
| LOPAC 01063 | 1.0000 |
| SPE02300205 | 1.0000 |
| active | Cluster 10977 | Additional Members: 9 | Rows returned: 3 |
| SPE01505384 | 0.307692307692308 |
| LOPAC 00613 | 0 |
| LOPAC 01063 | 0 |
Service provided by the
Mike Tyers Laboratory